Products 915916-89-1
CAS 915916-89-1 appears in our catalog under these names: N-(4-Methoxybenzyl)-N-methylbenzenesulfonamide, 98%, N-(4-Methoxybenzyl)-N-methylbenzenesulfonamide 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
N-[(4-methoxyphenyl)methyl]-N-methylbenzenesulfonamide (CAS 915916-89-1) is a chemical compound with the molecular formula C15H17NO3S and a molecular weight of 291.4 g/mol. IUPAC name: N-[(4-methoxyphenyl)methyl]-N-methylbenzenesulfonamide. InChIKey: MCUOPOJSLPOGIE-UHFFFAOYSA-N.
| Molecular formula | C15H17NO3S |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | N-[(4-methoxyphenyl)methyl]-N-methylbenzenesulfonamide |
| InChIKey | MCUOPOJSLPOGIE-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=C(C=C1)OC)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)