cas: 3393-96-2 — see every product listed under this CAS number, including other names
N-(4-Nitrophenyl)benzamide, 98%, 98% (CAS 3393-96-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LV2-1g |
| cas | 3393-96-2 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 155.60 Pln | |
| Chemat | 25g | 299.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(4-nitrophenyl)benzamide (CAS 3393-96-2) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: N-(4-nitrophenyl)benzamide. InChIKey: GMGQGZYFQSCZCW-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | N-(4-nitrophenyl)benzamide |
| InChIKey | GMGQGZYFQSCZCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)