Products 3393-96-2
CAS 3393-96-2 appears in our catalog under these names: N-(5-Nitro-pyridin-2-yl)-benzamide, 95%, 4'-Nitrobenzanilide, 98%, 4'–Nitrobenzanilide, 4'-Nitrobenzanilide, >98.0%(GC), 4'-Nitrobenzanilide. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 25g, 5g, 10g, 1g, 100g, 50mg, 0,5g.
N-(4-nitrophenyl)benzamide (CAS 3393-96-2) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: N-(4-nitrophenyl)benzamide. InChIKey: GMGQGZYFQSCZCW-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | N-(4-nitrophenyl)benzamide |
| InChIKey | GMGQGZYFQSCZCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)