Products 160411-70-1
CAS 160411-70-1 appears in our catalog under these names: Ethyl 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylate, 96%, ethyl 5-(4-cyanophenyl)isoxazole-3-carboxylate, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
Ethyl 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylate (CAS 160411-70-1) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: ethyl 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylate. InChIKey: KQKMMKWUFJZZEG-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | ethyl 5-(4-cyanophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | KQKMMKWUFJZZEG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)