CAS 2385-27-5 appears in our catalog under these names: 2-Nitrobenzanilide, 95%, 2-Nitro-N-phenylbenzamide, 97%, 2-Nitrobenzanilide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100g, 25g, 5g, 50g.
2-nitro-N-phenylbenzamide (CAS 2385-27-5) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: 2-nitro-N-phenylbenzamide. InChIKey: RNFCQIOHQPIUOI-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 2-nitro-N-phenylbenzamide |
| InChIKey | RNFCQIOHQPIUOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)