N-(4-Oxido-1,4l6-oxathian-4-ylidene)but-2-enamide, 95% （E）
cas: 2138808-40-7 — see every product listed under this CAS number, including other names
N-(4-Oxido-1,4l6-oxathian-4-ylidene)but-2-enamide, 95% （E） (CAS 2138808-40-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2944312-25mg |
| cas | 2138808-40-7 |
| size | 25mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 387.06 Pln | |
| Ambeed | 50mg | 604.00 Pln | |
| Ambeed | 100mg | 971.12 Pln | |
| Ambeed | 250mg | 1688.69 Pln | |
| Ambeed | 1g | 4447.69 Pln | |
| Ambeed | 5g | 17580.75 Pln | |
| BLDpharm | 25mg | 414.32 Pln | |
| BLDpharm | 50mg | 647.57 Pln | |
| BLDpharm | 100mg | 1041.88 Pln | |
| BLDpharm | 250mg | 1813.83 Pln | |
| BLDpharm | 1g | 4790.56 Pln | |
| BLDpharm | 5g | 18952.24 Pln |
properties
| purity | 95% （E） |
|---|---|
| delivery time | 2-3 weeks |
(E)-N-(4-oxo-1,4-oxathian-4-ylidene)but-2-enamide (CAS 2138808-40-7) is a chemical compound with the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. IUPAC name: (E)-N-(4-oxo-1,4-oxathian-4-ylidene)but-2-enamide. InChIKey: LGCOLIABPNEUCX-NSCUHMNNSA-N.
| Molecular formula | C8H13NO3S |
|---|---|
| Molecular weight | 203.26 g/mol |
| IUPAC name | (E)-N-(4-oxo-1,4-oxathian-4-ylidene)but-2-enamide |
| InChIKey | LGCOLIABPNEUCX-NSCUHMNNSA-N |
| SMILES | C/C=C/C(=O)N=S1(=O)CCOCC1 |
Computed by PubChem (NCBI)