Products 1451009-75-8

CAS 1451009-75-8 is the registry number for 3-(1H-Pyrrol-2-yl)propyl methanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(1H-pyrrol-2-yl)propyl methanesulfonate (CAS 1451009-75-8) is a chemical compound with the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. IUPAC name: 3-(1H-pyrrol-2-yl)propyl methanesulfonate. InChIKey: BWXUMIKYWSBQKR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13NO3S
Molecular weight203.26 g/mol
IUPAC name3-(1H-pyrrol-2-yl)propyl methanesulfonate
InChIKeyBWXUMIKYWSBQKR-UHFFFAOYSA-N
SMILESCS(=O)(=O)OCCCC1=CC=CN1

Computed by PubChem (NCBI)