CAS 1331907-55-1 appears in our catalog under these names: N–(Acetyl–d3)–S–allyl–L–cysteine, S-Allylmercapturic acid-d3. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg.
(2R)-3-prop-2-enylsulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid (CAS 1331907-55-1) is a chemical compound with the molecular formula C8H13NO3S and a molecular weight of 206.28 g/mol. IUPAC name: (2R)-3-prop-2-enylsulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid. InChIKey: LKRAEHUDIUJBSF-HMQROFFESA-N.
| Molecular formula | C8H13NO3S |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | (2R)-3-prop-2-enylsulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid |
| InChIKey | LKRAEHUDIUJBSF-HMQROFFESA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@@H](CSCC=C)C(=O)O |
Computed by PubChem (NCBI)