CAS 145452-04-6 appears in our catalog under these names: allyl acetyl-L-cysteinate, 98% +(stabilized with TBC), Acetylcysteine Impurity 16, N-Acetyl-L-cysteine Allyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 250mg.
Prop-2-enyl (2R)-2-acetamido-3-sulfanylpropanoate (CAS 145452-04-6) is a chemical compound with the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. IUPAC name: prop-2-enyl (2R)-2-acetamido-3-sulfanylpropanoate. InChIKey: KSHKPIFVSKLDQI-ZETCQYMHSA-N.
| Molecular formula | C8H13NO3S |
|---|---|
| Molecular weight | 203.26 g/mol |
| IUPAC name | prop-2-enyl (2R)-2-acetamido-3-sulfanylpropanoate |
| InChIKey | KSHKPIFVSKLDQI-ZETCQYMHSA-N |
| SMILES | CC(=O)N[C@@H](CS)C(=O)OCC=C |
Computed by PubChem (NCBI)