CAS 1477740-44-5 appears in our catalog under these names: 8-Thia-2-azaspiro(4.5)decan-3-one 8,8-dioxide, 90%, 8–Thia–2–azaspiro(4·5)decan–3–one 8，8–dioxide, 8-​Thia-​2-​azaspiro(4.5)​decan-​3-​one 8,​8-​dioxide, 8Lambda6-thia-2-azaspiro[4.5]decane-3,8,8-trione, 96%, 96%, 8-Thia-2-azaspiro[4.5]decan-3-one 8,8-dioxide, 96%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 0,5g, 5g, 250mg, 1g.
8,8-dioxo-8lambda6-thia-2-azaspiro[4.5]decan-3-one (CAS 1477740-44-5) is a chemical compound with the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. IUPAC name: 8,8-dioxo-8lambda6-thia-2-azaspiro[4.5]decan-3-one. InChIKey: WXRCDHNXDAYFRK-UHFFFAOYSA-N.
| Molecular formula | C8H13NO3S |
|---|---|
| Molecular weight | 203.26 g/mol |
| IUPAC name | 8,8-dioxo-8lambda6-thia-2-azaspiro[4.5]decan-3-one |
| InChIKey | WXRCDHNXDAYFRK-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC12CC(=O)NC2 |
Computed by PubChem (NCBI)