CAS 859489-28-4 is the registry number for N-Allyltetrahydrothiophene-3-carboxamide 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1-dioxo-N-prop-2-enylthiolane-3-carboxamide (CAS 859489-28-4) is a chemical compound with the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. IUPAC name: 1,1-dioxo-N-prop-2-enylthiolane-3-carboxamide. InChIKey: TUIVLNOEGLYKBV-UHFFFAOYSA-N.
| Molecular formula | C8H13NO3S |
|---|---|
| Molecular weight | 203.26 g/mol |
| IUPAC name | 1,1-dioxo-N-prop-2-enylthiolane-3-carboxamide |
| InChIKey | TUIVLNOEGLYKBV-UHFFFAOYSA-N |
| SMILES | C=CCNC(=O)C1CCS(=O)(=O)C1 |
Computed by PubChem (NCBI)