CAS 892310-77-9 is the registry number for N-(1,1-Dioxidotetrahydrothiophen-3-yl)cyclopropanecarboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothiolan-3-yl)cyclopropanecarboxamide (CAS 892310-77-9) is a chemical compound with the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. IUPAC name: N-(1,1-dioxothiolan-3-yl)cyclopropanecarboxamide. InChIKey: LNMJJGUUBYOTJX-UHFFFAOYSA-N.
| Molecular formula | C8H13NO3S |
|---|---|
| Molecular weight | 203.26 g/mol |
| IUPAC name | N-(1,1-dioxothiolan-3-yl)cyclopropanecarboxamide |
| InChIKey | LNMJJGUUBYOTJX-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)NC2CCS(=O)(=O)C2 |
Computed by PubChem (NCBI)