cas: 1482-62-8 — see every product listed under this CAS number, including other names
N-(4-chlorophenyl)-N'-cyano-Guanidine, 95%, 95% (CAS 1482-62-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112FJ8-250mg |
| cas | 1482-62-8 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 362.00 Pln | |
| Chemat | 5g | 938.00 Pln | |
| Chemat | 10g | 1528.40 Pln | |
| Chemat | 25g | 2896.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-chlorophenyl)-1-cyanoguanidine (CAS 1482-62-8) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 2-(4-chlorophenyl)-1-cyanoguanidine. InChIKey: JMEJOUCPQDFPFK-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1-cyanoguanidine |
| InChIKey | JMEJOUCPQDFPFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C(N)NC#N)Cl |
Computed by PubChem (NCBI)