cas: 173212-86-7 — see every product listed under this CAS number, including other names
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-O-methyl-L-homoserine, 98%, 98% (CAS 173212-86-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AOHW-100mg |
| cas | 173212-86-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 500mg | 232.40 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 10g | 1854.80 Pln | |
| Chemat | 25g | 4197.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxybutanoic acid (CAS 173212-86-7) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxybutanoic acid. InChIKey: JBIRUWVMQYLPPX-SFHVURJKSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxybutanoic acid |
| InChIKey | JBIRUWVMQYLPPX-SFHVURJKSA-N |
| SMILES | COCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)