CAS 884880-39-1 appears in our catalog under these names: Fmoc-(R)-2-amino-3-hydroxy-3-methylbutanoic acid, 95%, (R)–N–Fmoc–2–amino–3–hydroxy–3–methylbutanoic acid, Fmoc-beta,beta-diMe-D-Ser-OH, Fmoc-D-Val(3-OH)-OH 97%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-hydroxy-3-methylbutanoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 25g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-methylbutanoic acid (CAS 884880-39-1) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-methylbutanoic acid. InChIKey: KIOMNBRJPAICIT-KRWDZBQOSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-methylbutanoic acid |
| InChIKey | KIOMNBRJPAICIT-KRWDZBQOSA-N |
| SMILES | CC(C)([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)