Products 656243-36-6

CAS 656243-36-6 is the registry number for 1,2-Bis(4-methoxyphenyl)-6-oxopiperidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1,2-bis(4-methoxyphenyl)-6-oxopiperidine-3-carboxylic acid (CAS 656243-36-6) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: 1,2-bis(4-methoxyphenyl)-6-oxopiperidine-3-carboxylic acid. InChIKey: CJZDORXRRYGTMN-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21NO5
Molecular weight355.4 g/mol
IUPAC name1,2-bis(4-methoxyphenyl)-6-oxopiperidine-3-carboxylic acid
InChIKeyCJZDORXRRYGTMN-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2C(CCC(=O)N2C3=CC=C(C=C3)OC)C(=O)O

Computed by PubChem (NCBI)