CAS 252049-06-2 appears in our catalog under these names: Fmoc–N–Me–Thr–OH, Fmoc-N-Me-Thr-OH 98%, Fmoc-N-Me-Thr-OH, 97%, 97%, N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-methyl-L-threonine, 99.87%, Fmoc-N-Me-Thr-OH, 97%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 100mg, 250mg, 100g, 1 g.
(2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid (CAS 252049-06-2) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid. InChIKey: YBKRZKSVPNEMQK-XIKOKIGWSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid |
| InChIKey | YBKRZKSVPNEMQK-XIKOKIGWSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)