CAS 1217603-41-2 appears in our catalog under these names: Fmoc-(S)-2-amino-3-hydroxy-3-methylbutanoic acid, 96%, (2S)–2–(9H–Fluoren–9–ylmethoxycarbonylamino)–3–hydroxy–3–methylbutanoic acid, Fmoc-beta,beta-diMe-L-Ser-OH, Fmoc-(S)-2-amino-3-hydroxy-3-methylbutanoic acid, Fmoc-Val(3-OH)-OH 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 1g, 10g, 5g, 250mg, 25g, 50g, 100g, 250g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-methylbutanoic acid (CAS 1217603-41-2) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-methylbutanoic acid. InChIKey: KIOMNBRJPAICIT-QGZVFWFLSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-methylbutanoic acid |
| InChIKey | KIOMNBRJPAICIT-QGZVFWFLSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)