CAS 1301706-86-4 appears in our catalog under these names: Fmoc-D-Thr(Me)-OH, 97%, N–((9H–Fluoren–9–ylmethoxy)carbonyl)–O–methyl–D–threonine, Fmoc-D-Thr(Me)-OH, (2R,3S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methoxybutanoic acid, 97%, 97%, Fmoc-O-methyl-D-threonine, 99%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
(2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid (CAS 1301706-86-4) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid. InChIKey: BOGQZFFOTLSMMA-KPZWWZAWSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid |
| InChIKey | BOGQZFFOTLSMMA-KPZWWZAWSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC |
Computed by PubChem (NCBI)