CAS 928063-81-4 appears in our catalog under these names: (2S,3R)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-3-methoxybutanoic acid, 95%, Fmoc-L-Thr(Me)-OH, (2S,3R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methoxybutanoic acid, Fmoc-Thr(Me)-OH 95%, (2S,3R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methoxybutanoic acid, 98%, 98%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 25g, 50g, 100g, 100mg.
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid (CAS 928063-81-4) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid. InChIKey: BOGQZFFOTLSMMA-XIKOKIGWSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxybutanoic acid |
| InChIKey | BOGQZFFOTLSMMA-XIKOKIGWSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC |
Computed by PubChem (NCBI)