cas: 132201-33-3 — see every product listed under this CAS number, including other names
N-Benzoyl-(2R,3S)-3-phenylisoserine 97% (CAS 132201-33-3) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100375-10mg |
| cas | 132201-33-3 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 186.81 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1299.31 Pln | |
| Ambeed | 10g | 2139.25 Pln | |
| Ambeed | 25g | 3579.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100375 |
(2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoic acid (CAS 132201-33-3) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoic acid. InChIKey: HYJVYOWKYPNSTK-UONOGXRCSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoic acid |
| InChIKey | HYJVYOWKYPNSTK-UONOGXRCSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]([C@H](C(=O)O)O)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)