cas: 6320-63-4 — see every product listed under this CAS number, including other names
N-Benzylisonicotinamide, 95%, 95% (CAS 6320-63-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1270HV-250mg |
| cas | 6320-63-4 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 573.20 Pln | |
| Chemat | 5g | 1941.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-benzylpyridine-4-carboxamide (CAS 6320-63-4) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: N-benzylpyridine-4-carboxamide. InChIKey: YIGMDKYIWMVZDV-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | N-benzylpyridine-4-carboxamide |
| InChIKey | YIGMDKYIWMVZDV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)