CAS 13058-16-7 appears in our catalog under these names: Z–DL–Trp–OH, N-Cbz-DL-tryptophan/ 99.25% (existing batch purity), N-Carbobenzoxy-DL-tryptophan, >97.0%(T), Cbz-DL-Trp-OH 98%, Z-DL-Trp-OH, 98%, 98%. Offered by: GLPBio, TargetMol, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 13058-16-7) is a chemical compound with the molecular formula C19H18N2O4 and a molecular weight of 338.4 g/mol. IUPAC name: 3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: AHYFYYVVAXRMKB-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O4 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | AHYFYYVVAXRMKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)