cas: 20919-42-0 — see every product listed under this CAS number, including other names
N-Iodophthalimide, >98.0%(T) (CAS 20919-42-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I1052-5G |
| cas | 20919-42-0 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 408.46 Pln | |
| TCI | 25g | 1293.57 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
2-iodoisoindole-1,3-dione (CAS 20919-42-0) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 2-iodoisoindole-1,3-dione. InChIKey: ISZGNNPTDCJIIS-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 2-iodoisoindole-1,3-dione |
| InChIKey | ISZGNNPTDCJIIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)I |
Computed by PubChem (NCBI)