cas: 20919-42-0 — see every product listed under this CAS number, including other names
N-Iodophthalimide, 96%, 96% (CAS 20919-42-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113K3O-1g |
| cas | 20919-42-0 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 333.20 Pln | |
| Chemat | 25g | 1245.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-iodoisoindole-1,3-dione (CAS 20919-42-0) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 2-iodoisoindole-1,3-dione. InChIKey: ISZGNNPTDCJIIS-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 2-iodoisoindole-1,3-dione |
| InChIKey | ISZGNNPTDCJIIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)I |
Computed by PubChem (NCBI)