cas: 23530-42-9 — see every product listed under this CAS number, including other names
N-Isopropyl-2-nitrobenzenesulfonamide, 98%, 98% (CAS 23530-42-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113NLJ-1g |
| cas | 23530-42-9 |
| size | 1g |
| availability | 95g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 25g | 813.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-nitro-N-propan-2-ylbenzenesulfonamide (CAS 23530-42-9) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 2-nitro-N-propan-2-ylbenzenesulfonamide. InChIKey: AGNODYCWEZDMHI-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 2-nitro-N-propan-2-ylbenzenesulfonamide |
| InChIKey | AGNODYCWEZDMHI-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)