cas: 23530-42-9 — see every product listed under this CAS number, including other names
N-Isopropyl-2-nitrobenzenesulfonamide, 98% (CAS 23530-42-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F695305-1G |
| cas | 23530-42-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 482.14 Pln | |
| Fluorochem | 25g | 1434.93 Pln | |
| Fluorochem | 100g | 4688.99 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-nitro-N-propan-2-ylbenzenesulfonamide (CAS 23530-42-9) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 2-nitro-N-propan-2-ylbenzenesulfonamide. InChIKey: AGNODYCWEZDMHI-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 2-nitro-N-propan-2-ylbenzenesulfonamide |
| InChIKey | AGNODYCWEZDMHI-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)