cas: 166943-39-1 — see every product listed under this CAS number, including other names
N-Methyl-2-(4-nitrophenyl)ethanamine hydrochloride, 97% (CAS 166943-39-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225799-250MG |
| cas | 166943-39-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 25g | 310.33 Pln | |
| Fluorochem | 100g | 976.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-methyl-2-(4-nitrophenyl)ethanamine;hydrochloride (CAS 166943-39-1) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: N-methyl-2-(4-nitrophenyl)ethanamine;hydrochloride. InChIKey: VGJDSNZOPPZCTB-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | N-methyl-2-(4-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | VGJDSNZOPPZCTB-UHFFFAOYSA-N |
| SMILES | CNCCC1=CC=C(C=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)