cas: 55750-63-5 — see every product listed under this CAS number, including other names
N-Succinimidyl 6-maleimidohexanoate, 98%, 98% (CAS 55750-63-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TCH-100mg |
| cas | 55750-63-5 |
| size | 100mg |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 50g | 477.20 Pln | |
| Chemat | 100g | 750.80 Pln | |
| Chemat | 250g | 1682.00 Pln | |
| Chemat | 500g | 3235.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 6-(2,5-dioxopyrrol-1-yl)hexanoate (CAS 55750-63-5) is a chemical compound with the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 6-(2,5-dioxopyrrol-1-yl)hexanoate. InChIKey: VLARLSIGSPVYHX-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O6 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| InChIKey | VLARLSIGSPVYHX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)