cas: 54672-12-7 — see every product listed under this CAS number, including other names
N1,N1-DIMETHYL-2-(TRIFLUOROMETHYL)BENZENE-1,4-DIAMINE, 98% (CAS 54672-12-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F828101-250MG |
| cas | 54672-12-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1185.02 Pln | |
| Fluorochem | 10g | 2309.62 Pln | |
| Fluorochem | 25g | 5688.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-N,1-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine (CAS 54672-12-7) is a chemical compound with the molecular formula C9H11F3N2 and a molecular weight of 204.19 g/mol. IUPAC name: 1-N,1-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine. InChIKey: ZQEWNTUETRXSRX-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 1-N,1-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine |
| InChIKey | ZQEWNTUETRXSRX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)