CAS 54672-12-7 appears in our catalog under these names: N1,N1-Dimethyl-2-(trifluoromethyl)benzene-1,4-diamine, 95%, N1,N1-Dimethyl-2-(trifluoromethyl)benzene-1,4-diamine 95%, N1,N1-Dimethyl-2-(trifluoromethyl)benzene-1,4-diamine, 97%, 97%, N1,N1-DIMETHYL-2-(TRIFLUOROMETHYL)BENZENE-1,4-DIAMINE, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg, 25g.
1-N,1-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine (CAS 54672-12-7) is a chemical compound with the molecular formula C9H11F3N2 and a molecular weight of 204.19 g/mol. IUPAC name: 1-N,1-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine. InChIKey: ZQEWNTUETRXSRX-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 1-N,1-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine |
| InChIKey | ZQEWNTUETRXSRX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)