CAS 1213451-38-7 is the registry number for (R)-4-(1-Amino-2,2,2-trifluoroethyl)-2-methylaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-methylaniline (CAS 1213451-38-7) is a chemical compound with the molecular formula C9H11F3N2 and a molecular weight of 204.19 g/mol. IUPAC name: 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-methylaniline. InChIKey: FKZFLSJBVJPYAD-MRVPVSSYSA-N.
| Molecular formula | C9H11F3N2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-2-methylaniline |
| InChIKey | FKZFLSJBVJPYAD-MRVPVSSYSA-N |
| SMILES | CC1=C(C=CC(=C1)[C@H](C(F)(F)F)N)N |
Computed by PubChem (NCBI)