CAS 1092294-95-5 is the registry number for N1,N1-Dimethyl-5-(trifluoromethyl)benzene-1,2-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-N,2-N-dimethyl-4-(trifluoromethyl)benzene-1,2-diamine (CAS 1092294-95-5) is a chemical compound with the molecular formula C9H11F3N2 and a molecular weight of 204.19 g/mol. IUPAC name: 2-N,2-N-dimethyl-4-(trifluoromethyl)benzene-1,2-diamine. InChIKey: PBFFWOPJSKLXRM-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 2-N,2-N-dimethyl-4-(trifluoromethyl)benzene-1,2-diamine |
| InChIKey | PBFFWOPJSKLXRM-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=CC(=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)