CAS 183251-95-8 appears in our catalog under these names: N1,N1-Dimethyl-4-(trifluoromethyl)-1,2-benzenediamine, 95%, N1,N1-dimethyl-4-(trifluoromethyl)-1,2-benzenediamine, N1,N1-Dimethyl-4-(trifluoromethyl)benzene-1,2-diamine, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 25g.
1-N,1-N-dimethyl-4-(trifluoromethyl)benzene-1,2-diamine (CAS 183251-95-8) is a chemical compound with the molecular formula C9H11F3N2 and a molecular weight of 204.19 g/mol. IUPAC name: 1-N,1-N-dimethyl-4-(trifluoromethyl)benzene-1,2-diamine. InChIKey: CTAFZNWWARLWMI-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 1-N,1-N-dimethyl-4-(trifluoromethyl)benzene-1,2-diamine |
| InChIKey | CTAFZNWWARLWMI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)