CAS 73164-30-4 appears in our catalog under these names: 1-N,1-N-Dimethyl-3-(trifluoromethyl)benzene-1,4-diamine, 98%, N1,N1-Dimethyl-3-(trifluoromethyl)benzene-1,4-diamine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-N,4-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine (CAS 73164-30-4) is a chemical compound with the molecular formula C9H11F3N2 and a molecular weight of 204.19 g/mol. IUPAC name: 4-N,4-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine. InChIKey: VRPUKJBVBYRCNY-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 4-N,4-N-dimethyl-2-(trifluoromethyl)benzene-1,4-diamine |
| InChIKey | VRPUKJBVBYRCNY-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)