Products 1040043-27-3
CAS 1040043-27-3 appears in our catalog under these names: 1-N-Ethyl-3-(trifluoromethyl)benzene-1,4-diamine, 1-N-Ethyl-3-(trifluoromethyl)benzene-1,4-diamine, 98%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 250mg, 2,5g, 5g, 1g.
4-N-ethyl-2-(trifluoromethyl)benzene-1,4-diamine (CAS 1040043-27-3) is a chemical compound with the molecular formula C9H11F3N2 and a molecular weight of 204.19 g/mol. IUPAC name: 4-N-ethyl-2-(trifluoromethyl)benzene-1,4-diamine. InChIKey: SGZFOKFZGQSKFJ-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 4-N-ethyl-2-(trifluoromethyl)benzene-1,4-diamine |
| InChIKey | SGZFOKFZGQSKFJ-UHFFFAOYSA-N |
| SMILES | CCNC1=CC(=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)