CAS 51244-45-2 appears in our catalog under these names: NSC31150, NSC 31150/ 98.07% (existing batch purity), 5-(2,4-dichlorobenzylidene)-1,3-thiazolidine-2,4-dione, 98%, 98%, Antimicrobial agent-33. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 10 mg, 1 mg.
(5Z)-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (CAS 51244-45-2) is a chemical compound with the molecular formula C10H5Cl2NO2S and a molecular weight of 274.12 g/mol. IUPAC name: (5Z)-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: XUOVOGTZQNQWFV-BAQGIRSFSA-N.
| Molecular formula | C10H5Cl2NO2S |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | (5Z)-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | XUOVOGTZQNQWFV-BAQGIRSFSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)/C=C\2/C(=O)NC(=O)S2 |
Computed by PubChem (NCBI)