Products 1178420-52-4
CAS 1178420-52-4 appears in our catalog under these names: 2–(3,5–Dichlorophenyl)thiazole–4–carboxylic acid, 2-(3,5-Dichlorophenyl)thiazole-4-carboxylic acid 95%, 2-(3,5-Dichlorophenyl)thiazole-4-carboxylic acid, 98%, 2-(3,5-Dichlorophenyl)thiazole-4-carboxylic acid, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-(3,5-dichlorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 1178420-52-4) is a chemical compound with the molecular formula C10H5Cl2NO2S and a molecular weight of 274.12 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: PNWWAVUFGSARND-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2S |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | PNWWAVUFGSARND-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)