Products 257876-07-6

CAS 257876-07-6 is the registry number for 2-(2,3-Dichlorophenyl)-1,3-thiazole-4-carboxylic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2,3-dichlorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 257876-07-6) is a chemical compound with the molecular formula C10H5Cl2NO2S and a molecular weight of 274.12 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: ANTJCNIMRNBFMJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5Cl2NO2S
Molecular weight274.12 g/mol
IUPAC name2-(2,3-dichlorophenyl)-1,3-thiazole-4-carboxylic acid
InChIKeyANTJCNIMRNBFMJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)Cl)C2=NC(=CS2)C(=O)O

Computed by PubChem (NCBI)