CAS 257876-07-6 is the registry number for 2-(2,3-Dichlorophenyl)-1,3-thiazole-4-carboxylic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g, 5g.
2-(2,3-dichlorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 257876-07-6) is a chemical compound with the molecular formula C10H5Cl2NO2S and a molecular weight of 274.12 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: ANTJCNIMRNBFMJ-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2S |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | ANTJCNIMRNBFMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)