CAS 1094263-32-7 appears in our catalog under these names: 2-(3,4-Dichlorophenyl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(3,4-Dichlorophenyl)-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
2-(3,4-dichlorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 1094263-32-7) is a chemical compound with the molecular formula C10H5Cl2NO2S and a molecular weight of 274.12 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: DWDLMDDOUHTLON-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2S |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | DWDLMDDOUHTLON-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC(=CS2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)