Products 1423033-15-1

CAS 1423033-15-1 appears in our catalog under these names: 3-(3,4-Dichlorophenyl)-1,2-thiazole-5-carboxylic acid, 95%, 3-(3,4-Dichlorophenyl)-1,2-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

3-(3,4-dichlorophenyl)-1,2-thiazole-5-carboxylic acid (CAS 1423033-15-1) is a chemical compound with the molecular formula C10H5Cl2NO2S and a molecular weight of 274.12 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)-1,2-thiazole-5-carboxylic acid. InChIKey: QTLIDVLLXZMPJE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5Cl2NO2S
Molecular weight274.12 g/mol
IUPAC name3-(3,4-dichlorophenyl)-1,2-thiazole-5-carboxylic acid
InChIKeyQTLIDVLLXZMPJE-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C2=NSC(=C2)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)