Products 1094355-53-9
CAS 1094355-53-9 is the registry number for 2-(2,4-Dichlorophenyl)thiazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(2,4-dichlorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 1094355-53-9) is a chemical compound with the molecular formula C10H5Cl2NO2S and a molecular weight of 274.12 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: BAMRISRVXZTIMQ-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2S |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | BAMRISRVXZTIMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)