cas: 66464-26-4 — see every product listed under this CAS number, including other names
Oxazole, 2-(2,6-difluorophenyl)-4,5-dihydro-4,4-dimethyl-, 95%+, 95%+ (CAS 66464-26-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12GYHF-1g |
| cas | 66464-26-4 |
| size | 1g |
| availability | 12g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 755.60 Pln | |
| Chemat | 5g | 2022.80 Pln | |
| Chemat | 10g | 2930.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
2-(2,6-difluorophenyl)-4,4-dimethyl-5H-1,3-oxazole (CAS 66464-26-4) is a chemical compound with the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. IUPAC name: 2-(2,6-difluorophenyl)-4,4-dimethyl-5H-1,3-oxazole. InChIKey: PJTVMGSOYRAPIP-UHFFFAOYSA-N.
| Molecular formula | C11H11F2NO |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | PJTVMGSOYRAPIP-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=C(C=CC=C2F)F)C |
Computed by PubChem (NCBI)