CAS 385380-62-1 appears in our catalog under these names: (2,3-Difluorophenyl)(pyrrolidin-1-yl)methanone, 95%, (2,3-Difluorophenyl)(pyrrolidin-1-yl)methanone, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
(2,3-difluorophenyl)-pyrrolidin-1-ylmethanone (CAS 385380-62-1) is a chemical compound with the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. IUPAC name: (2,3-difluorophenyl)-pyrrolidin-1-ylmethanone. InChIKey: HIMBTZNXIVPALB-UHFFFAOYSA-N.
| Molecular formula | C11H11F2NO |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | (2,3-difluorophenyl)-pyrrolidin-1-ylmethanone |
| InChIKey | HIMBTZNXIVPALB-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=C(C(=CC=C2)F)F |
Computed by PubChem (NCBI)