CAS 154258-41-0 appears in our catalog under these names: 1-(3,5-Difluorophenyl)-3-(dimethylamino)prop-2-en-1-one, 95%, 1-(3,5-Difluorophenyl)-3-(dimethylamino)prop-2-en-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
(E)-1-(3,5-difluorophenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 154258-41-0) is a chemical compound with the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. IUPAC name: (E)-1-(3,5-difluorophenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: GCZWINPSKRVANB-ONEGZZNKSA-N.
| Molecular formula | C11H11F2NO |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | (E)-1-(3,5-difluorophenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | GCZWINPSKRVANB-ONEGZZNKSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC(=CC(=C1)F)F |
Computed by PubChem (NCBI)