CAS 1016680-08-2 appears in our catalog under these names: 1-(2,4-Difluorophenyl)piperidin-4-one, 95%, 1-(2,4-Difluorophenyl)piperidin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(2,4-difluorophenyl)piperidin-4-one (CAS 1016680-08-2) is a chemical compound with the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. IUPAC name: 1-(2,4-difluorophenyl)piperidin-4-one. InChIKey: IPHZDXYCDOEZDZ-UHFFFAOYSA-N.
| Molecular formula | C11H11F2NO |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)piperidin-4-one |
| InChIKey | IPHZDXYCDOEZDZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)