Products 885275-07-0
CAS 885275-07-0 is the registry number for 1-(3,4-Difluoro-phenyl)-piperidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
1-(3,4-difluorophenyl)piperidin-4-one (CAS 885275-07-0) is a chemical compound with the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. IUPAC name: 1-(3,4-difluorophenyl)piperidin-4-one. InChIKey: OQVXHVMMKRCNKU-UHFFFAOYSA-N.
| Molecular formula | C11H11F2NO |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)piperidin-4-one |
| InChIKey | OQVXHVMMKRCNKU-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)