CAS 66464-26-4 appears in our catalog under these names: 2-(2,6-Difluorophenyl)-4,4-dimethyl-4,5-dihydrooxazole, 95%, 2-(2,6-Difluorophenyl)-4,4-dimethyl-4,5-dihydrooxazole, 97%, Oxazole, 2-(2,6-difluorophenyl)-4,5-dihydro-4,4-dimethyl-, 95%+, 95%+. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 250mg, 25g, 10g, 1g.
2-(2,6-difluorophenyl)-4,4-dimethyl-5H-1,3-oxazole (CAS 66464-26-4) is a chemical compound with the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. IUPAC name: 2-(2,6-difluorophenyl)-4,4-dimethyl-5H-1,3-oxazole. InChIKey: PJTVMGSOYRAPIP-UHFFFAOYSA-N.
| Molecular formula | C11H11F2NO |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | PJTVMGSOYRAPIP-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=C(C=CC=C2F)F)C |
Computed by PubChem (NCBI)