Products 138716-25-3
CAS 138716-25-3 is the registry number for 1-(2,6-Difluorophenyl)-3-(dimethylamino)prop-2-en-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(E)-1-(2,6-difluorophenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 138716-25-3) is a chemical compound with the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. IUPAC name: (E)-1-(2,6-difluorophenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: ROSHJWFSGZURNS-VOTSOKGWSA-N.
| Molecular formula | C11H11F2NO |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | (E)-1-(2,6-difluorophenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | ROSHJWFSGZURNS-VOTSOKGWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=C(C=CC=C1F)F |
Computed by PubChem (NCBI)