CAS 55689-65-1 appears in our catalog under these names: Oxepinac/ 99.88% (existing batch purity), Oxepinac. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
2-(11-oxo-6H-benzo[c][1]benzoxepin-3-yl)acetic acid (CAS 55689-65-1) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 2-(11-oxo-6H-benzo[c][1]benzoxepin-3-yl)acetic acid. InChIKey: PYIHCGFQQSKYBO-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 2-(11-oxo-6H-benzo[c][1]benzoxepin-3-yl)acetic acid |
| InChIKey | PYIHCGFQQSKYBO-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)C3=C(O1)C=C(C=C3)CC(=O)O |
Computed by PubChem (NCBI)